C21H31O4- — CID 134858955
2-[(1R,2E,3S)-2-[(E)-4-methoxy-4-oxobut-2-enylidene]-3-methyl-3-(3-methylidene-6-oxohexyl)cyclopentyl]propan-2-olate (PubChem CID 134858955) has the molecular formula C21H31O4- and a molecular weight of 347.48 g/mol. Its IUPAC name is 2-[(1R,2E,3S)-2-[(E)-4-methoxy-4-oxobut-2-enylidene]-3-methyl-3-(3-methylidene-6-oxohexyl)cyclopentyl]propan-2-olate.
| Compound Name | 2-[(1R,2E,3S)-2-[(E)-4-methoxy-4-oxobut-2-enylidene]-3-methyl-3-(3-methylidene-6-oxohexyl)cyclopentyl]propan-2-olate |
|---|---|
| PubChem CID | 134858955 |
| Molecular Formula | C21H31O4- |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 2-[(1R,2E,3S)-2-[(E)-4-methoxy-4-oxobut-2-enylidene]-3-methyl-3-(3-methylidene-6-oxohexyl)cyclopentyl]propan-2-olate |
| SMILES | C=C(CCC=O)CC[C@]1(C)CC[C@@H](C(C)(C)[O-])/C1=C\C=C\C(=O)OC |
| InChI | InChI=1S/C21H31O4/c1-16(8-7-15-22)11-13-21(4)14-12-17(20(2,3)24)18(21)9-6-10-19(23)25-5/h6,9-10,15,17H,1,7-8,11-14H2,2-5H3/q-1/b10-6+,18-9+/t17-,21-/m1/s1 |
| InChIKey | KOCKUMDQBDGYHX-LSKLNASISA-N |
| XLogP | 3.51 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|