C11H21INO3+ — CID 134859319
tert-butyl N-hydroxy-N-[2-[(2R)-2-methyl-iodoniacycloprop-2-yl]propan-2-yl]carbamate (PubChem CID 134859319) has the molecular formula C11H21INO3+ and a molecular weight of 342.20 g/mol. Its IUPAC name is tert-butyl N-hydroxy-N-[2-[(2R)-2-methyl-iodoniacycloprop-2-yl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-hydroxy-N-[2-[(2R)-2-methyl-iodoniacycloprop-2-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 134859319 |
| Molecular Formula | C11H21INO3+ |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | tert-butyl N-hydroxy-N-[2-[(2R)-2-methyl-iodoniacycloprop-2-yl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(O)C(C)(C)[C@]1(C)C[I+]1 |
| InChI | InChI=1S/C11H21INO3/c1-9(2,3)16-8(14)13(15)10(4,5)11(6)7-12-11/h15H,7H2,1-6H3/q+1/t11-/m0/s1 |
| InChIKey | HHVXEXKOPCBICZ-NSHDSACASA-N |
| XLogP | -0.75 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|