C13H23NO2S2 — CID 134859329
tert-butyl 2-(1,3-dithian-2-yl)pyrrolidine-1-carboxylate (PubChem CID 134859329) has the molecular formula C13H23NO2S2 and a molecular weight of 289.47 g/mol. Its IUPAC name is tert-butyl 2-(1,3-dithian-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(1,3-dithian-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134859329 |
| Molecular Formula | C13H23NO2S2 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | tert-butyl 2-(1,3-dithian-2-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C1SCCCS1 |
| InChI | InChI=1S/C13H23NO2S2/c1-13(2,3)16-12(15)14-7-4-6-10(14)11-17-8-5-9-18-11/h10-11H,4-9H2,1-3H3 |
| InChIKey | PVUGOMIBDYSZLN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |