C12H18O5 — CID 134859522
(4S,5R)-5-[(2R)-2-(methoxymethoxy)but-3-yn-2-yl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 134859522) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is (4S,5R)-5-[(2R)-2-(methoxymethoxy)but-3-yn-2-yl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4S,5R)-5-[(2R)-2-(methoxymethoxy)but-3-yn-2-yl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 134859522 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (4S,5R)-5-[(2R)-2-(methoxymethoxy)but-3-yn-2-yl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | C#C[C@@](C)(OCOC)[C@@H]1OC(C)(C)O[C@@H]1C=O |
| InChI | InChI=1S/C12H18O5/c1-6-12(4,15-8-14-5)10-9(7-13)16-11(2,3)17-10/h1,7,9-10H,8H2,2-5H3/t9-,10-,12-/m1/s1 |
| InChIKey | NNECLYTWEYNWSS-CKYFFXLPSA-N |
| XLogP | 0.72 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|