C10H14O4 — CID 130035265
2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methoxybut-3-ynal (PubChem CID 130035265) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methoxybut-3-ynal.
| Compound Name | 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methoxybut-3-ynal |
|---|---|
| PubChem CID | 130035265 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methoxybut-3-ynal |
| SMILES | C#CC(C=O)(OC)C1COC(C)(C)O1 |
| InChI | InChI=1S/C10H14O4/c1-5-10(7-11,12-4)8-6-13-9(2,3)14-8/h1,7-8H,6H2,2-4H3 |
| InChIKey | FVEXDCJMSSWHOW-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|