C8H14O4 — CID 100927028
(2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyacetaldehyde (PubChem CID 100927028) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is (2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyacetaldehyde.
| Compound Name | (2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyacetaldehyde |
|---|---|
| PubChem CID | 100927028 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyacetaldehyde |
| SMILES | CO[C@H](C=O)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C8H14O4/c1-8(2)11-5-7(12-8)6(4-9)10-3/h4,6-7H,5H2,1-3H3/t6-,7+/m1/s1 |
| InChIKey | SUTDYTGUUOQMPB-RQJHMYQMSA-N |
| XLogP | 0.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|