C9H16O3 — CID 12641463
(4R,5S)-5-ethyl-2,2,4-trimethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 12641463) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (4R,5S)-5-ethyl-2,2,4-trimethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4R,5S)-5-ethyl-2,2,4-trimethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 12641463 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (4R,5S)-5-ethyl-2,2,4-trimethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | CC[C@@H]1OC(C)(C)O[C@@]1(C)C=O |
| InChI | InChI=1S/C9H16O3/c1-5-7-9(4,6-10)12-8(2,3)11-7/h6-7H,5H2,1-4H3/t7-,9-/m0/s1 |
| InChIKey | HLLAHROXBKQMSC-CBAPKCEASA-N |
| XLogP | 1.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|