C16H26O2Si — CID 134859694
(4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methylidene-4,5,7,7a-tetrahydro-1H-inden-2-one (PubChem CID 134859694) has the molecular formula C16H26O2Si and a molecular weight of 278.47 g/mol. Its IUPAC name is (4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methylidene-4,5,7,7a-tetrahydro-1H-inden-2-one.
| Compound Name | (4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methylidene-4,5,7,7a-tetrahydro-1H-inden-2-one |
|---|---|
| PubChem CID | 134859694 |
| Molecular Formula | C16H26O2Si |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methylidene-4,5,7,7a-tetrahydro-1H-inden-2-one |
| SMILES | C=C1CC2CC(=O)C=C2[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C16H26O2Si/c1-11-7-12-9-13(17)10-14(12)15(8-11)18-19(5,6)16(2,3)4/h10,12,15H,1,7-9H2,2-6H3/t12?,15-/m1/s1 |
| InChIKey | NFCLUIVCELFCOT-WPZCJLIBSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|