C15H26O3Si — CID 134861149
4-[[(2E,4E)-hexa-2,4-dienoxy]-dimethylsilyl]pent-4-enyl acetate (PubChem CID 134861149) has the molecular formula C15H26O3Si and a molecular weight of 282.46 g/mol. Its IUPAC name is 4-[[(2E,4E)-hexa-2,4-dienoxy]-dimethylsilyl]pent-4-enyl acetate.
| Compound Name | 4-[[(2E,4E)-hexa-2,4-dienoxy]-dimethylsilyl]pent-4-enyl acetate |
|---|---|
| PubChem CID | 134861149 |
| Molecular Formula | C15H26O3Si |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 4-[[(2E,4E)-hexa-2,4-dienoxy]-dimethylsilyl]pent-4-enyl acetate |
| SMILES | C=C(CCCOC(C)=O)[Si](C)(C)OC/C=C/C=C/C |
| InChI | InChI=1S/C15H26O3Si/c1-6-7-8-9-13-18-19(4,5)14(2)11-10-12-17-15(3)16/h6-9H,2,10-13H2,1,3-5H3/b7-6+,9-8+ |
| InChIKey | RENJTRGVTFGEJZ-BLHCBFLLSA-N |
| XLogP | 3.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|