C19H36O3Si — CID 10065871
[(4E,6Z)-8-[tert-butyl(dimethyl)silyl]oxyocta-4,6-dienyl] 2,2-dimethylpropanoate (PubChem CID 10065871) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is [(4E,6Z)-8-[tert-butyl(dimethyl)silyl]oxyocta-4,6-dienyl] 2,2-dimethylpropanoate.
| Compound Name | [(4E,6Z)-8-[tert-butyl(dimethyl)silyl]oxyocta-4,6-dienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10065871 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | [(4E,6Z)-8-[tert-butyl(dimethyl)silyl]oxyocta-4,6-dienyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCC/C=C/C=C\CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O3Si/c1-18(2,3)17(20)21-15-13-11-9-10-12-14-16-22-23(7,8)19(4,5)6/h9-10,12,14H,11,13,15-16H2,1-8H3/b10-9+,14-12- |
| InChIKey | QQDHZTHBSQTJIS-MVFBISMYSA-N |
| XLogP | 5.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|