C15H26O5 — CID 134861208
diethyl 2-[(2R,3S)-2-ethenyl-3-hydroxy-4-methylpentyl]propanedioate (PubChem CID 134861208) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is diethyl 2-[(2R,3S)-2-ethenyl-3-hydroxy-4-methylpentyl]propanedioate.
| Compound Name | diethyl 2-[(2R,3S)-2-ethenyl-3-hydroxy-4-methylpentyl]propanedioate |
|---|---|
| PubChem CID | 134861208 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | diethyl 2-[(2R,3S)-2-ethenyl-3-hydroxy-4-methylpentyl]propanedioate |
| SMILES | C=C[C@@H](CC(C(=O)OCC)C(=O)OCC)[C@@H](O)C(C)C |
| InChI | InChI=1S/C15H26O5/c1-6-11(13(16)10(4)5)9-12(14(17)19-7-2)15(18)20-8-3/h6,10-13,16H,1,7-9H2,2-5H3/t11-,13-/m0/s1 |
| InChIKey | VJTALNPRVATAMT-AAEUAGOBSA-N |
| XLogP | 1.94 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|