C11H21NO2 — CID 134861233
(5R)-5-heptyl-5-methyl-1,3-oxazolidin-2-one (PubChem CID 134861233) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is (5R)-5-heptyl-5-methyl-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-heptyl-5-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134861233 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (5R)-5-heptyl-5-methyl-1,3-oxazolidin-2-one |
| SMILES | CCCCCCC[C@]1(C)CNC(=O)O1 |
| InChI | InChI=1S/C11H21NO2/c1-3-4-5-6-7-8-11(2)9-12-10(13)14-11/h3-9H2,1-2H3,(H,12,13)/t11-/m1/s1 |
| InChIKey | PMJHAGZJPNRMNE-LLVKDONJSA-N |
| XLogP | 2.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|