C13H25NO2 — CID 14836209
5-decyl-1,3-oxazolidin-2-one (PubChem CID 14836209) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 5-decyl-1,3-oxazolidin-2-one.
| Compound Name | 5-decyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 14836209 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 5-decyl-1,3-oxazolidin-2-one |
| SMILES | CCCCCCCCCCC1CNC(=O)O1 |
| InChI | InChI=1S/C13H25NO2/c1-2-3-4-5-6-7-8-9-10-12-11-14-13(15)16-12/h12H,2-11H2,1H3,(H,14,15) |
| InChIKey | FSPXPXCKJBRDDS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|