C14H30O4Si — CID 134863284
(E,2S)-6-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)hex-4-en-1-ol (PubChem CID 134863284) has the molecular formula C14H30O4Si and a molecular weight of 290.48 g/mol. Its IUPAC name is (E,2S)-6-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)hex-4-en-1-ol.
| Compound Name | (E,2S)-6-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)hex-4-en-1-ol |
|---|---|
| PubChem CID | 134863284 |
| Molecular Formula | C14H30O4Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (E,2S)-6-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)hex-4-en-1-ol |
| SMILES | COCO[C@H](CO)C/C=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30O4Si/c1-14(2,3)19(5,6)18-10-8-7-9-13(11-15)17-12-16-4/h7-8,13,15H,9-12H2,1-6H3/b8-7+/t13-/m0/s1 |
| InChIKey | MIMMPBMFFFHUIS-GWJCSSMESA-N |
| XLogP | 2.94 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|