C12H22O3Si — CID 11276561
(E,3R,4S)-3-(methoxymethoxy)-1-trimethylsilylhept-5-en-1-yn-4-ol (PubChem CID 11276561) has the molecular formula C12H22O3Si and a molecular weight of 242.39 g/mol. Its IUPAC name is (E,3R,4S)-3-(methoxymethoxy)-1-trimethylsilylhept-5-en-1-yn-4-ol.
| Compound Name | (E,3R,4S)-3-(methoxymethoxy)-1-trimethylsilylhept-5-en-1-yn-4-ol |
|---|---|
| PubChem CID | 11276561 |
| Molecular Formula | C12H22O3Si |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (E,3R,4S)-3-(methoxymethoxy)-1-trimethylsilylhept-5-en-1-yn-4-ol |
| SMILES | C/C=C/[C@H](O)[C@@H](C#C[Si](C)(C)C)OCOC |
| InChI | InChI=1S/C12H22O3Si/c1-6-7-11(13)12(15-10-14-2)8-9-16(3,4)5/h6-7,11-13H,10H2,1-5H3/b7-6+/t11-,12+/m0/s1 |
| InChIKey | HCDIDGBCJVFFNS-FNSAGKMKSA-N |
| XLogP | 1.79 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|