C21H28F3NO9 — CID 134864059
ethyl (3R)-3-[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]amino]-3-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanoate (PubChem CID 134864059) has the molecular formula C21H28F3NO9 and a molecular weight of 495.45 g/mol. Its IUPAC name is ethyl (3R)-3-[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]amino]-3-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanoate.
| Compound Name | ethyl (3R)-3-[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]amino]-3-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanoate |
|---|---|
| PubChem CID | 134864059 |
| Molecular Formula | C21H28F3NO9 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | ethyl (3R)-3-[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]amino]-3-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanoate |
| SMILES | CCOC(=O)C[C@@H](NC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H28F3NO9/c1-3-33-14(27)9-12(18-17(30)16(29)15(28)13(10-26)34-18)25-19(31)20(32-2,21(22,23)24)11-7-5-4-6-8-11/h4-8,12-13,15-18,26,28-30H,3,9-10H2,1-2H3,(H,25,31)/t12-,13-,15+,16+,17-,18-,20-/m1/s1 |
| InChIKey | MWKLNSDXIFGFLL-OIDFPDJLSA-N |
| XLogP | -0.63 |
| TPSA | 154.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |