C17H24O8S — CID 134864879
[(3aS,4S,6aR)-4-[(1S)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-methylbenzenesulfonate (PubChem CID 134864879) has the molecular formula C17H24O8S and a molecular weight of 388.44 g/mol. Its IUPAC name is [(3aS,4S,6aR)-4-[(1S)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3aS,4S,6aR)-4-[(1S)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134864879 |
| Molecular Formula | C17H24O8S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | [(3aS,4S,6aR)-4-[(1S)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2O[C@@H]([C@@H](O)CO)[C@@H]3OC(C)(C)O[C@H]23)cc1 |
| InChI | InChI=1S/C17H24O8S/c1-10-4-6-11(7-5-10)26(20,21)22-9-13-15-16(25-17(2,3)24-15)14(23-13)12(19)8-18/h4-7,12-16,18-19H,8-9H2,1-3H3/t12-,13?,14-,15+,16-/m0/s1 |
| InChIKey | NAQNIOIOWDHGSS-IXIBIKRGSA-N |
| XLogP | 0.34 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|