C22H20Br2O2 — CID 134865576
1,5-bis[(4-bromophenyl)methyl]-2,4-dimethoxybenzene (PubChem CID 134865576) has the molecular formula C22H20Br2O2 and a molecular weight of 476.21 g/mol. Its IUPAC name is 1,5-bis[(4-bromophenyl)methyl]-2,4-dimethoxybenzene.
| Compound Name | 1,5-bis[(4-bromophenyl)methyl]-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 134865576 |
| Molecular Formula | C22H20Br2O2 |
| Molecular Weight | 476.21 g/mol |
| Exact Mass | 473.98 |
| IUPAC Name | 1,5-bis[(4-bromophenyl)methyl]-2,4-dimethoxybenzene |
| SMILES | COc1cc(OC)c(Cc2ccc(Br)cc2)cc1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H20Br2O2/c1-25-21-14-22(26-2)18(12-16-5-9-20(24)10-6-16)13-17(21)11-15-3-7-19(23)8-4-15/h3-10,13-14H,11-12H2,1-2H3 |
| InChIKey | PCQXBZLEDLATLJ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.21 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |