C16H26O4 — CID 134866016
(4aR,9S,11aS)-3,3,6,6,9-pentamethyl-4a,5,7a,8,9,10-hexahydro-1H-[1,3]dioxino[4,5-d]chromen-11-one (PubChem CID 134866016) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is (4aR,9S,11aS)-3,3,6,6,9-pentamethyl-4a,5,7a,8,9,10-hexahydro-1H-[1,3]dioxino[4,5-d]chromen-11-one.
| Compound Name | (4aR,9S,11aS)-3,3,6,6,9-pentamethyl-4a,5,7a,8,9,10-hexahydro-1H-[1,3]dioxino[4,5-d]chromen-11-one |
|---|---|
| PubChem CID | 134866016 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (4aR,9S,11aS)-3,3,6,6,9-pentamethyl-4a,5,7a,8,9,10-hexahydro-1H-[1,3]dioxino[4,5-d]chromen-11-one |
| SMILES | C[C@@H]1CC(=O)[C@]23COC(C)(C)O[C@@H]2CC(C)(C)OC3C1 |
| InChI | InChI=1S/C16H26O4/c1-10-6-11(17)16-9-18-15(4,5)20-13(16)8-14(2,3)19-12(16)7-10/h10,12-13H,6-9H2,1-5H3/t10-,12?,13-,16+/m1/s1 |
| InChIKey | WMPVERHXVSUVEN-MPLZVYLWSA-N |
| XLogP | 2.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |