C43H46N2O5 — CID 134866261
2,6-bis[[(2S)-2-[hydroxy(diphenyl)methyl]-1-oxidopyrrolidin-1-ium-1-yl]methyl]-4-methylphenol (PubChem CID 134866261) has the molecular formula C43H46N2O5 and a molecular weight of 670.85 g/mol. Its IUPAC name is 2,6-bis[[(2S)-2-[hydroxy(diphenyl)methyl]-1-oxidopyrrolidin-1-ium-1-yl]methyl]-4-methylphenol.
| Compound Name | 2,6-bis[[(2S)-2-[hydroxy(diphenyl)methyl]-1-oxidopyrrolidin-1-ium-1-yl]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 134866261 |
| Molecular Formula | C43H46N2O5 |
| Molecular Weight | 670.85 g/mol |
| Exact Mass | 670.34 |
| IUPAC Name | 2,6-bis[[(2S)-2-[hydroxy(diphenyl)methyl]-1-oxidopyrrolidin-1-ium-1-yl]methyl]-4-methylphenol |
| SMILES | Cc1cc(C[N+]2([O-])CCC[C@H]2C(O)(c2ccccc2)c2ccccc2)c(O)c(C[N+]2([O-])CCC[C@H]2C(O)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C43H46N2O5/c1-32-28-33(30-44(49)26-14-24-39(44)42(47,35-16-6-2-7-17-35)36-18-8-3-9-19-36)41(46)34(29-32)31-45(50)27-15-25-40(45)43(48,37-20-10-4-11-21-37)38-22-12-5-13-23-38/h2-13,16-23,28-29,39-40,46-48H,14-15,24-27,30-31H2,1H3/t39-,40-,44?,45?/m0/s1 |
| InChIKey | KWYXJCPFGNFBHQ-YAWLGJIHSA-N |
| XLogP | 7.53 |
| TPSA | 106.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.85 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|