C20H16O4 — CID 134866479
methyl 2-(1',3'-dioxospiro[1,3-dihydroindene-2,2'-indene]-1-yl)acetate (PubChem CID 134866479) has the molecular formula C20H16O4 and a molecular weight of 320.34 g/mol. Its IUPAC name is methyl 2-(1',3'-dioxospiro[1,3-dihydroindene-2,2'-indene]-1-yl)acetate.
| Compound Name | methyl 2-(1',3'-dioxospiro[1,3-dihydroindene-2,2'-indene]-1-yl)acetate |
|---|---|
| PubChem CID | 134866479 |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | methyl 2-(1',3'-dioxospiro[1,3-dihydroindene-2,2'-indene]-1-yl)acetate |
| SMILES | COC(=O)CC1c2ccccc2CC12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H16O4/c1-24-17(21)10-16-13-7-3-2-6-12(13)11-20(16)18(22)14-8-4-5-9-15(14)19(20)23/h2-9,16H,10-11H2,1H3 |
| InChIKey | RFYKXEJWKTVEOK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|