C18H20O5 — CID 134866807
dimethyl (1Z,7Z,10Z)-15-oxatricyclo[10.2.1.02,7]pentadeca-1,7,10,13-tetraene-10,11-dicarboxylate (PubChem CID 134866807) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is dimethyl (1Z,7Z,10Z)-15-oxatricyclo[10.2.1.02,7]pentadeca-1,7,10,13-tetraene-10,11-dicarboxylate.
| Compound Name | dimethyl (1Z,7Z,10Z)-15-oxatricyclo[10.2.1.02,7]pentadeca-1,7,10,13-tetraene-10,11-dicarboxylate |
|---|---|
| PubChem CID | 134866807 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | dimethyl (1Z,7Z,10Z)-15-oxatricyclo[10.2.1.02,7]pentadeca-1,7,10,13-tetraene-10,11-dicarboxylate |
| SMILES | COC(=O)/C1=C(\C(=O)OC)C2C=C/C(=C3\CCCC\C3=C\C1)O2 |
| InChI | InChI=1S/C18H20O5/c1-21-17(19)13-8-7-11-5-3-4-6-12(11)14-9-10-15(23-14)16(13)18(20)22-2/h7,9-10,15H,3-6,8H2,1-2H3/b11-7-,14-12-,16-13- |
| InChIKey | WGAKKOKOLVOMCS-STHVMBQRSA-N |
| XLogP | 2.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |