C21H36OSi — CID 134866917
tert-butyl-dimethyl-[(4E,6E,8E,12E)-pentadeca-4,6,8,12,14-pentaenoxy]silane (PubChem CID 134866917) has the molecular formula C21H36OSi and a molecular weight of 332.60 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(4E,6E,8E,12E)-pentadeca-4,6,8,12,14-pentaenoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(4E,6E,8E,12E)-pentadeca-4,6,8,12,14-pentaenoxy]silane |
|---|---|
| PubChem CID | 134866917 |
| Molecular Formula | C21H36OSi |
| Molecular Weight | 332.60 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | tert-butyl-dimethyl-[(4E,6E,8E,12E)-pentadeca-4,6,8,12,14-pentaenoxy]silane |
| SMILES | C=C/C=C/CC/C=C/C=C/C=C/CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36OSi/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-23(5,6)21(2,3)4/h7-9,12-17H,1,10-11,18-20H2,2-6H3/b9-8+,13-12+,15-14+,17-16+ |
| InChIKey | DRBWJTBAZNIYIN-QTMCTTMVSA-N |
| XLogP | 6.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.60 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|