C17H20NS- — CID 134867449
N-[(2S)-1-cyclopenta-1,3-dien-1-ylsulfanyl-3-methylbutan-2-yl]-1-phenylmethanimine (PubChem CID 134867449) has the molecular formula C17H20NS- and a molecular weight of 270.42 g/mol. Its IUPAC name is N-[(2S)-1-cyclopenta-1,3-dien-1-ylsulfanyl-3-methylbutan-2-yl]-1-phenylmethanimine.
| Compound Name | N-[(2S)-1-cyclopenta-1,3-dien-1-ylsulfanyl-3-methylbutan-2-yl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 134867449 |
| Molecular Formula | C17H20NS- |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | N-[(2S)-1-cyclopenta-1,3-dien-1-ylsulfanyl-3-methylbutan-2-yl]-1-phenylmethanimine |
| SMILES | CC(C)[C@@H](CSc1ccc[cH-]1)/N=C/c1ccccc1 |
| InChI | InChI=1S/C17H20NS/c1-14(2)17(13-19-16-10-6-7-11-16)18-12-15-8-4-3-5-9-15/h3-12,14,17H,13H2,1-2H3/q-1/b18-12+/t17-/m1/s1 |
| InChIKey | FDVHPFIKMXVQGP-YPOUMIDOSA-N |
| XLogP | 4.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|