C18H22NS- — CID 135037418
N-[(2S)-1-cyclopenta-1,3-dien-1-ylsulfanyl-3,3-dimethylbutan-2-yl]-1-phenylmethanimine (PubChem CID 135037418) has the molecular formula C18H22NS- and a molecular weight of 284.45 g/mol. Its IUPAC name is N-[(2S)-1-cyclopenta-1,3-dien-1-ylsulfanyl-3,3-dimethylbutan-2-yl]-1-phenylmethanimine.
| Compound Name | N-[(2S)-1-cyclopenta-1,3-dien-1-ylsulfanyl-3,3-dimethylbutan-2-yl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 135037418 |
| Molecular Formula | C18H22NS- |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | N-[(2S)-1-cyclopenta-1,3-dien-1-ylsulfanyl-3,3-dimethylbutan-2-yl]-1-phenylmethanimine |
| SMILES | CC(C)(C)[C@@H](CSc1ccc[cH-]1)/N=C/c1ccccc1 |
| InChI | InChI=1S/C18H22NS/c1-18(2,3)17(14-20-16-11-7-8-12-16)19-13-15-9-5-4-6-10-15/h4-13,17H,14H2,1-3H3/q-1/b19-13+/t17-/m1/s1 |
| InChIKey | RLBUYEIWAJXDPQ-HNMKQIAWSA-N |
| XLogP | 5.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|