C11H20O3 — CID 134868169
(E)-6,6-diethoxy-4-methylhex-3-en-2-one (PubChem CID 134868169) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (E)-6,6-diethoxy-4-methylhex-3-en-2-one.
| Compound Name | (E)-6,6-diethoxy-4-methylhex-3-en-2-one |
|---|---|
| PubChem CID | 134868169 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (E)-6,6-diethoxy-4-methylhex-3-en-2-one |
| SMILES | CCOC(C/C(C)=C/C(C)=O)OCC |
| InChI | InChI=1S/C11H20O3/c1-5-13-11(14-6-2)8-9(3)7-10(4)12/h7,11H,5-6,8H2,1-4H3/b9-7+ |
| InChIKey | ZTLJJUVZFYKFIT-VQHVLOKHSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|