C10H18O3 — CID 5324027
(Z)-5,5-diethoxy-3-methylpent-2-enal (PubChem CID 5324027) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (Z)-5,5-diethoxy-3-methylpent-2-enal.
| Compound Name | (Z)-5,5-diethoxy-3-methylpent-2-enal |
|---|---|
| PubChem CID | 5324027 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (Z)-5,5-diethoxy-3-methylpent-2-enal |
| SMILES | CCOC(C/C(C)=C\C=O)OCC |
| InChI | InChI=1S/C10H18O3/c1-4-12-10(13-5-2)8-9(3)6-7-11/h6-7,10H,4-5,8H2,1-3H3/b9-6- |
| InChIKey | DMCAMSMCWBWYFR-TWGQIWQCSA-N |
| XLogP | 1.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|