C27H25O3P — CID 134868693
(1-methoxy-2,4,6-triphenyl-1λ5-phosphacyclohexa-1,3,5-trien-1-yl) propanoate (PubChem CID 134868693) has the molecular formula C27H25O3P and a molecular weight of 428.47 g/mol. Its IUPAC name is (1-methoxy-2,4,6-triphenyl-1λ5-phosphacyclohexa-1,3,5-trien-1-yl) propanoate.
| Compound Name | (1-methoxy-2,4,6-triphenyl-1λ5-phosphacyclohexa-1,3,5-trien-1-yl) propanoate |
|---|---|
| PubChem CID | 134868693 |
| Molecular Formula | C27H25O3P |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | (1-methoxy-2,4,6-triphenyl-1λ5-phosphacyclohexa-1,3,5-trien-1-yl) propanoate |
| SMILES | CCC(=O)OP1(OC)=C(c2ccccc2)C=C(c2ccccc2)C=C1c1ccccc1 |
| InChI | InChI=1S/C27H25O3P/c1-3-27(28)30-31(29-2)25(22-15-9-5-10-16-22)19-24(21-13-7-4-8-14-21)20-26(31)23-17-11-6-12-18-23/h4-20H,3H2,1-2H3 |
| InChIKey | XLUXIMBKMAMMNV-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|