C21H22NO3P — CID 4868190
N-(1,1-dimethoxy-2,6-diphenyl-1λ5-phosphacyclohexa-1,3,5-trien-4-yl)acetamide (PubChem CID 4868190) has the molecular formula C21H22NO3P and a molecular weight of 367.39 g/mol. Its IUPAC name is N-(1,1-dimethoxy-2,6-diphenyl-1λ5-phosphacyclohexa-1,3,5-trien-4-yl)acetamide.
| Compound Name | N-(1,1-dimethoxy-2,6-diphenyl-1λ5-phosphacyclohexa-1,3,5-trien-4-yl)acetamide |
|---|---|
| PubChem CID | 4868190 |
| Molecular Formula | C21H22NO3P |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | N-(1,1-dimethoxy-2,6-diphenyl-1λ5-phosphacyclohexa-1,3,5-trien-4-yl)acetamide |
| SMILES | COP1(OC)=C(c2ccccc2)C=C(NC(C)=O)C=C1c1ccccc1 |
| InChI | InChI=1S/C21H22NO3P/c1-16(23)22-19-14-20(17-10-6-4-7-11-17)26(24-2,25-3)21(15-19)18-12-8-5-9-13-18/h4-15H,1-3H3,(H,22,23) |
| InChIKey | ZXJSSBBJTJQUGF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|