C24H27NO2S — CID 134869110
(1R,2S)-2-(dibenzylamino)-1-(4-methylsulfanylphenyl)propane-1,3-diol (PubChem CID 134869110) has the molecular formula C24H27NO2S and a molecular weight of 393.55 g/mol. Its IUPAC name is (1R,2S)-2-(dibenzylamino)-1-(4-methylsulfanylphenyl)propane-1,3-diol.
| Compound Name | (1R,2S)-2-(dibenzylamino)-1-(4-methylsulfanylphenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 134869110 |
| Molecular Formula | C24H27NO2S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | (1R,2S)-2-(dibenzylamino)-1-(4-methylsulfanylphenyl)propane-1,3-diol |
| SMILES | CSc1ccc([C@@H](O)[C@H](CO)N(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H27NO2S/c1-28-22-14-12-21(13-15-22)24(27)23(18-26)25(16-19-8-4-2-5-9-19)17-20-10-6-3-7-11-20/h2-15,23-24,26-27H,16-18H2,1H3/t23-,24+/m0/s1 |
| InChIKey | ODYCZOGHLVITOP-BJKOFHAPSA-N |
| XLogP | 4.51 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |