C20H21NO4 — CID 134870615
ethyl 2-[(3R,5R,6S)-2-oxo-5,6-diphenylmorpholin-3-yl]acetate (PubChem CID 134870615) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is ethyl 2-[(3R,5R,6S)-2-oxo-5,6-diphenylmorpholin-3-yl]acetate.
| Compound Name | ethyl 2-[(3R,5R,6S)-2-oxo-5,6-diphenylmorpholin-3-yl]acetate |
|---|---|
| PubChem CID | 134870615 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | ethyl 2-[(3R,5R,6S)-2-oxo-5,6-diphenylmorpholin-3-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1N[C@H](c2ccccc2)[C@H](c2ccccc2)OC1=O |
| InChI | InChI=1S/C20H21NO4/c1-2-24-17(22)13-16-20(23)25-19(15-11-7-4-8-12-15)18(21-16)14-9-5-3-6-10-14/h3-12,16,18-19,21H,2,13H2,1H3/t16-,18-,19+/m1/s1 |
| InChIKey | VFLDIGJHUGRZLR-QRQLOZEOSA-N |
| XLogP | 2.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |