C16H21NO5 — CID 134872087
[1-(tert-butylamino)-3-(4-methoxyphenyl)-1,3-dioxopropan-2-yl] acetate (PubChem CID 134872087) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is [1-(tert-butylamino)-3-(4-methoxyphenyl)-1,3-dioxopropan-2-yl] acetate.
| Compound Name | [1-(tert-butylamino)-3-(4-methoxyphenyl)-1,3-dioxopropan-2-yl] acetate |
|---|---|
| PubChem CID | 134872087 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | [1-(tert-butylamino)-3-(4-methoxyphenyl)-1,3-dioxopropan-2-yl] acetate |
| SMILES | COc1ccc(C(=O)C(OC(C)=O)C(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H21NO5/c1-10(18)22-14(15(20)17-16(2,3)4)13(19)11-6-8-12(21-5)9-7-11/h6-9,14H,1-5H3,(H,17,20) |
| InChIKey | ASUAALSHFAKODE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|