C11H19O7+ — CID 134872733
[(4S,5S)-4,5-bis(ethoxycarbonyl)-1,3-dioxolan-2-yl]-ethyloxidanium (PubChem CID 134872733) has the molecular formula C11H19O7+ and a molecular weight of 263.27 g/mol. Its IUPAC name is [(4S,5S)-4,5-bis(ethoxycarbonyl)-1,3-dioxolan-2-yl]-ethyloxidanium.
| Compound Name | [(4S,5S)-4,5-bis(ethoxycarbonyl)-1,3-dioxolan-2-yl]-ethyloxidanium |
|---|---|
| PubChem CID | 134872733 |
| Molecular Formula | C11H19O7+ |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | [(4S,5S)-4,5-bis(ethoxycarbonyl)-1,3-dioxolan-2-yl]-ethyloxidanium |
| SMILES | CCOC(=O)[C@H]1OC([OH+]CC)O[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C11H18O7/c1-4-14-9(12)7-8(10(13)15-5-2)18-11(17-7)16-6-3/h7-8,11H,4-6H2,1-3H3/p+1/t7-,8-/m0/s1 |
| InChIKey | AAMNGUSKZJTJDF-YUMQZZPRSA-O |
| XLogP | -0.27 |
| TPSA | 83.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|