C13H28N3+ — CID 134873323
[(E)-1,3-bis(dimethylamino)-4,4-dimethylpent-2-enylidene]-dimethylazanium (PubChem CID 134873323) has the molecular formula C13H28N3+ and a molecular weight of 226.39 g/mol. Its IUPAC name is [(E)-1,3-bis(dimethylamino)-4,4-dimethylpent-2-enylidene]-dimethylazanium.
| Compound Name | [(E)-1,3-bis(dimethylamino)-4,4-dimethylpent-2-enylidene]-dimethylazanium |
|---|---|
| PubChem CID | 134873323 |
| Molecular Formula | C13H28N3+ |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | [(E)-1,3-bis(dimethylamino)-4,4-dimethylpent-2-enylidene]-dimethylazanium |
| SMILES | CN(C)C(/C=C(/N(C)C)C(C)(C)C)=[N+](C)C |
| InChI | InChI=1S/C13H28N3/c1-13(2,3)11(14(4)5)10-12(15(6)7)16(8)9/h10H,1-9H3/q+1 |
| InChIKey | JISJOJATSQPKNM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|