About 2-methoxydec-1-en-1-one
2-methoxydec-1-en-1-one (PubChem CID 134874211) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-methoxydec-1-en-1-one.
Molecular Properties
| Compound Name | 2-methoxydec-1-en-1-one |
| PubChem CID | 134874211 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 2-methoxydec-1-en-1-one |
| SMILES | CCCCCCCCC(=C=O)OC |
| InChI | InChI=1S/C11H20O2/c1-3-4-5-6-7-8-9-11(10-12)13-2/h3-9H2,1-2H3 |
| InChIKey | SEZIEORHIWPLSN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxydec-1-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxydec-1-en-1-one?
The IUPAC name of 2-methoxydec-1-en-1-one (CID 134874211) is 2-methoxydec-1-en-1-one.
What is the SMILES notation for 2-methoxydec-1-en-1-one?
The canonical SMILES for 2-methoxydec-1-en-1-one is CCCCCCCCC(=C=O)OC.
What is the InChIKey of 2-methoxydec-1-en-1-one?
The InChIKey is SEZIEORHIWPLSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-3-4-5-6-7-8-9-11(10-12)13-2/h3-9H2,1-2H3.
What are the key properties of 2-methoxydec-1-en-1-one?
2-methoxydec-1-en-1-one has a molecular weight of 184.28 g/mol, XLogP of 3.10, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxydec-1-en-1-one is sourced from PubChem (CID 134874211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).