C25H21NO3 — CID 134874362
9H-fluoren-9-ylmethyl N-[(2S)-4-oxo-1-phenylbut-3-en-2-yl]carbamate (PubChem CID 134874362) has the molecular formula C25H21NO3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-4-oxo-1-phenylbut-3-en-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-4-oxo-1-phenylbut-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 134874362 |
| Molecular Formula | C25H21NO3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-4-oxo-1-phenylbut-3-en-2-yl]carbamate |
| SMILES | O=C=C[C@H](Cc1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H21NO3/c27-15-14-19(16-18-8-2-1-3-9-18)26-25(28)29-17-24-22-12-6-4-10-20(22)21-11-5-7-13-23(21)24/h1-14,19,24H,16-17H2,(H,26,28)/t19-/m1/s1 |
| InChIKey | FKBPKXXOGSRPJI-LJQANCHMSA-N |
| XLogP | 4.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|