C35H61NO5Si — CID 134874861
[(2S)-1-[[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-en-2-yl]-methylamino]-3-methyl-1-oxobutan-2-yl] (2R,3S)-3-hydroxy-2-methyldecanoate (PubChem CID 134874861) has the molecular formula C35H61NO5Si and a molecular weight of 603.96 g/mol. Its IUPAC name is [(2S)-1-[[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-en-2-yl]-methylamino]-3-methyl-1-oxobutan-2-yl] (2R,3S)-3-hydroxy-2-methyldecanoate.
| Compound Name | [(2S)-1-[[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-en-2-yl]-methylamino]-3-methyl-1-oxobutan-2-yl] (2R,3S)-3-hydroxy-2-methyldecanoate |
|---|---|
| PubChem CID | 134874861 |
| Molecular Formula | C35H61NO5Si |
| Molecular Weight | 603.96 g/mol |
| Exact Mass | 603.43 |
| IUPAC Name | [(2S)-1-[[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylhex-5-en-2-yl]-methylamino]-3-methyl-1-oxobutan-2-yl] (2R,3S)-3-hydroxy-2-methyldecanoate |
| SMILES | C=CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](Cc1ccccc1)N(C)C(=O)[C@@H](OC(=O)[C@H](C)[C@@H](O)CCCCCCC)C(C)C |
| InChI | InChI=1S/C35H61NO5Si/c1-12-14-15-16-20-24-30(37)27(5)34(39)40-32(26(3)4)33(38)36(9)29(25-28-22-18-17-19-23-28)31(21-13-2)41-42(10,11)35(6,7)8/h13,17-19,22-23,26-27,29-32,37H,2,12,14-16,20-21,24-25H2,1,3-11H3/t27-,29+,30+,31-,32+/m1/s1 |
| InChIKey | JIEMAKUIJZMHLK-SWMBRKMBSA-N |
| XLogP | 7.95 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.96 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|