C19H22O3S — CID 134874884
methyl 2-(3-oxo-2-pent-2-ynyl-2-phenylsulfanylcyclopentyl)acetate (PubChem CID 134874884) has the molecular formula C19H22O3S and a molecular weight of 330.45 g/mol. Its IUPAC name is methyl 2-(3-oxo-2-pent-2-ynyl-2-phenylsulfanylcyclopentyl)acetate.
| Compound Name | methyl 2-(3-oxo-2-pent-2-ynyl-2-phenylsulfanylcyclopentyl)acetate |
|---|---|
| PubChem CID | 134874884 |
| Molecular Formula | C19H22O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | methyl 2-(3-oxo-2-pent-2-ynyl-2-phenylsulfanylcyclopentyl)acetate |
| SMILES | CCC#CCC1(Sc2ccccc2)C(=O)CCC1CC(=O)OC |
| InChI | InChI=1S/C19H22O3S/c1-3-4-8-13-19(23-16-9-6-5-7-10-16)15(11-12-17(19)20)14-18(21)22-2/h5-7,9-10,15H,3,11-14H2,1-2H3 |
| InChIKey | NXXCTIMVGJRKMU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|