C14H16O3S — CID 14225594
methyl 2-[(1S)-3-oxocyclopentyl]-2-phenylsulfanylacetate (PubChem CID 14225594) has the molecular formula C14H16O3S and a molecular weight of 264.35 g/mol. Its IUPAC name is methyl 2-[(1S)-3-oxocyclopentyl]-2-phenylsulfanylacetate.
| Compound Name | methyl 2-[(1S)-3-oxocyclopentyl]-2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 14225594 |
| Molecular Formula | C14H16O3S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | methyl 2-[(1S)-3-oxocyclopentyl]-2-phenylsulfanylacetate |
| SMILES | COC(=O)C(Sc1ccccc1)[C@H]1CCC(=O)C1 |
| InChI | InChI=1S/C14H16O3S/c1-17-14(16)13(10-7-8-11(15)9-10)18-12-5-3-2-4-6-12/h2-6,10,13H,7-9H2,1H3/t10-,13?/m0/s1 |
| InChIKey | YHDPNZJLZRWSNM-NKUHCKNESA-N |
| XLogP | 2.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |