About 2-[(2Z)-2-(1,2-dichloro-2-oxoethylidene)hydrazinyl]benzoyl chloride
2-[(2Z)-2-(1,2-dichloro-2-oxoethylidene)hydrazinyl]benzoyl chloride (PubChem CID 134876150) has the molecular formula C9H5Cl3N2O2
and a molecular weight of 279.51 g/mol. Its IUPAC name is 2-[(2Z)-2-(1,2-dichloro-2-oxoethylidene)hydrazinyl]benzoyl chloride.
Molecular Properties
| Compound Name | 2-[(2Z)-2-(1,2-dichloro-2-oxoethylidene)hydrazinyl]benzoyl chloride |
| PubChem CID | 134876150 |
| Molecular Formula | C9H5Cl3N2O2 |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 277.94 |
| IUPAC Name | 2-[(2Z)-2-(1,2-dichloro-2-oxoethylidene)hydrazinyl]benzoyl chloride |
| SMILES | O=C(Cl)/C(Cl)=N/Nc1ccccc1C(=O)Cl |
| InChI | InChI=1S/C9H5Cl3N2O2/c10-7(9(12)16)14-13-6-4-2-1-3-5(6)8(11)15/h1-4,13H/b14-7- |
| InChIKey | XTJIDCSFEPUPHI-AUWJEWJLSA-N |
| XLogP | 2.80 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2Z)-2-(1,2-dichloro-2-oxoethylidene)hydrazinyl]benzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2Z)-2-(1,2-dichloro-2-oxoethylidene)hydrazinyl]benzoyl chloride?
The IUPAC name of 2-[(2Z)-2-(1,2-dichloro-2-oxoethylidene)hydrazinyl]benzoyl chloride (CID 134876150) is 2-[(2Z)-2-(1,2-dichloro-2-oxoethylidene)hydrazinyl]benzoyl chloride.
What is the SMILES notation for 2-[(2Z)-2-(1,2-dichloro-2-oxoethylidene)hydrazinyl]benzoyl chloride?
The canonical SMILES for 2-[(2Z)-2-(1,2-dichloro-2-oxoethylidene)hydrazinyl]benzoyl chloride is O=C(Cl)/C(Cl)=N/Nc1ccccc1C(=O)Cl.
What is the InChIKey of 2-[(2Z)-2-(1,2-dichloro-2-oxoethylidene)hydrazinyl]benzoyl chloride?
The InChIKey is XTJIDCSFEPUPHI-AUWJEWJLSA-N. The full InChI is InChI=1S/C9H5Cl3N2O2/c10-7(9(12)16)14-13-6-4-2-1-3-5(6)8(11)15/h1-4,13H/b14-7-.
What are the key properties of 2-[(2Z)-2-(1,2-dichloro-2-oxoethylidene)hydrazinyl]benzoyl chloride?
2-[(2Z)-2-(1,2-dichloro-2-oxoethylidene)hydrazinyl]benzoyl chloride has a molecular weight of 279.51 g/mol, XLogP of 2.80, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2Z)-2-(1,2-dichloro-2-oxoethylidene)hydrazinyl]benzoyl chloride is sourced from PubChem (CID 134876150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).