2-(naphthalen-1-ylamino)benzoyl chloride

C17H12ClNO — CID 54450707

IUPAC2-(naphthalen-1-ylamino)benzoyl chloride
SMILESO=C(Cl)c1ccccc1Nc1cccc2ccccc12
InChIInChI=1S/C17H12ClNO/c18-17(20)14-9-3-4-10-16(14)19-15-11-5-7-12-6-1-2-8-13(12)15/h1-11,19H
InChIKeyWUTQUGOOASLLGR-UHFFFAOYSA-N
MW281.74 g/mol
LogP4.96
Rot. Bonds3

About 2-(naphthalen-1-ylamino)benzoyl chloride

2-(naphthalen-1-ylamino)benzoyl chloride (PubChem CID 54450707) has the molecular formula C17H12ClNO and a molecular weight of 281.74 g/mol. Its IUPAC name is 2-(naphthalen-1-ylamino)benzoyl chloride.

Molecular Properties

Compound Name2-(naphthalen-1-ylamino)benzoyl chloride
PubChem CID54450707
Molecular FormulaC17H12ClNO
Molecular Weight281.74 g/mol
Exact Mass281.06
IUPAC Name2-(naphthalen-1-ylamino)benzoyl chloride
SMILESO=C(Cl)c1ccccc1Nc1cccc2ccccc12
InChIInChI=1S/C17H12ClNO/c18-17(20)14-9-3-4-10-16(14)19-15-11-5-7-12-6-1-2-8-13(12)15/h1-11,19H
InChIKeyWUTQUGOOASLLGR-UHFFFAOYSA-N
XLogP4.96
TPSA29.10 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.74
LogP ≤ 54.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-(naphthalen-1-ylamino)benzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(naphthalen-1-ylamino)benzoyl chloride?
The IUPAC name of 2-(naphthalen-1-ylamino)benzoyl chloride (CID 54450707) is 2-(naphthalen-1-ylamino)benzoyl chloride.
What is the SMILES notation for 2-(naphthalen-1-ylamino)benzoyl chloride?
The canonical SMILES for 2-(naphthalen-1-ylamino)benzoyl chloride is O=C(Cl)c1ccccc1Nc1cccc2ccccc12.
What is the InChIKey of 2-(naphthalen-1-ylamino)benzoyl chloride?
The InChIKey is WUTQUGOOASLLGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12ClNO/c18-17(20)14-9-3-4-10-16(14)19-15-11-5-7-12-6-1-2-8-13(12)15/h1-11,19H.
What are the key properties of 2-(naphthalen-1-ylamino)benzoyl chloride?
2-(naphthalen-1-ylamino)benzoyl chloride has a molecular weight of 281.74 g/mol, XLogP of 4.96, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(naphthalen-1-ylamino)benzoyl chloride is sourced from PubChem (CID 54450707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).