C22H31NO7 — CID 134876636
N-[(3aS,4R,6S,6aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]-2-phenylmethoxyethanimine oxide (PubChem CID 134876636) has the molecular formula C22H31NO7 and a molecular weight of 421.49 g/mol. Its IUPAC name is N-[(3aS,4R,6S,6aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]-2-phenylmethoxyethanimine oxide.
| Compound Name | N-[(3aS,4R,6S,6aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]-2-phenylmethoxyethanimine oxide |
|---|---|
| PubChem CID | 134876636 |
| Molecular Formula | C22H31NO7 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | N-[(3aS,4R,6S,6aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]-2-phenylmethoxyethanimine oxide |
| SMILES | CC1(C)OC[C@H]([C@H]2O[C@H](/[N+]([O-])=C/COCc3ccccc3)[C@H]3OC(C)(C)O[C@@]23C)O1 |
| InChI | InChI=1S/C22H31NO7/c1-20(2)26-14-16(28-20)17-22(5)18(29-21(3,4)30-22)19(27-17)23(24)11-12-25-13-15-9-7-6-8-10-15/h6-11,16-19H,12-14H2,1-5H3/b23-11-/t16-,17-,18-,19+,22+/m1/s1 |
| InChIKey | MLUOYJPSJFOJIO-JZZFUVKTSA-N |
| XLogP | 2.57 |
| TPSA | 81.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|