C20H21N3O2 — CID 134877093
(2Z,3R,4R)-2-benzylidene-4-morpholin-4-yl-3-phenyl-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 134877093) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is (2Z,3R,4R)-2-benzylidene-4-morpholin-4-yl-3-phenyl-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z,3R,4R)-2-benzylidene-4-morpholin-4-yl-3-phenyl-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 134877093 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (2Z,3R,4R)-2-benzylidene-4-morpholin-4-yl-3-phenyl-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | [O-]C1=N/[N+](=C\c2ccccc2)[C@H](c2ccccc2)[C@H]1N1CCOCC1 |
| InChI | InChI=1S/C20H21N3O2/c24-20-19(22-11-13-25-14-12-22)18(17-9-5-2-6-10-17)23(21-20)15-16-7-3-1-4-8-16/h1-10,15,18-19H,11-14H2/b23-15-/t18-,19-/m1/s1 |
| InChIKey | MGTZBYPGIMYFDD-NNCBWZTOSA-N |
| XLogP | 1.25 |
| TPSA | 50.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|