C22H23N3O — CID 134925647
(2Z,3R,4R)-2-benzylidene-4-[bis(prop-2-enyl)amino]-3-phenyl-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 134925647) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is (2Z,3R,4R)-2-benzylidene-4-[bis(prop-2-enyl)amino]-3-phenyl-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z,3R,4R)-2-benzylidene-4-[bis(prop-2-enyl)amino]-3-phenyl-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 134925647 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | (2Z,3R,4R)-2-benzylidene-4-[bis(prop-2-enyl)amino]-3-phenyl-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | C=CCN(CC=C)[C@H]1C([O-])=N/[N+](=C\c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H23N3O/c1-3-15-24(16-4-2)21-20(19-13-9-6-10-14-19)25(23-22(21)26)17-18-11-7-5-8-12-18/h3-14,17,20-21H,1-2,15-16H2/b25-17-/t20-,21-/m1/s1 |
| InChIKey | USHJGIPWWSQBKR-CUGVELAUSA-N |
| XLogP | 2.59 |
| TPSA | 41.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|