C17H16N2O — CID 166446312
(2Z)-2-benzylidene-3-(4-methylphenyl)-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 166446312) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is (2Z)-2-benzylidene-3-(4-methylphenyl)-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z)-2-benzylidene-3-(4-methylphenyl)-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 166446312 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | (2Z)-2-benzylidene-3-(4-methylphenyl)-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | Cc1ccc(C2CC([O-])=N/[N+]2=C\c2ccccc2)cc1 |
| InChI | InChI=1S/C17H16N2O/c1-13-7-9-15(10-8-13)16-11-17(20)18-19(16)12-14-5-3-2-4-6-14/h2-10,12,16H,11H2,1H3/b19-12- |
| InChIKey | RTJXBNBIEMVDCY-UNOMPAQXSA-N |
| XLogP | 2.25 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|