C17H21N3O — CID 134925281
(2Z,4S)-2-[(4-cyanophenyl)methylidene]-4-hexyl-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 134925281) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is (2Z,4S)-2-[(4-cyanophenyl)methylidene]-4-hexyl-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z,4S)-2-[(4-cyanophenyl)methylidene]-4-hexyl-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 134925281 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | (2Z,4S)-2-[(4-cyanophenyl)methylidene]-4-hexyl-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | CCCCCC[C@H]1C/[N+](=C/c2ccc(C#N)cc2)N=C1[O-] |
| InChI | InChI=1S/C17H21N3O/c1-2-3-4-5-6-16-13-20(19-17(16)21)12-15-9-7-14(11-18)8-10-15/h7-10,12,16H,2-6,13H2,1H3/b20-12-/t16-/m0/s1 |
| InChIKey | OWLFLNQRWAEWMN-DEFALTHMSA-N |
| XLogP | 2.26 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|