C13H13N3O — CID 46919349
(1Z)-1-[(4-cyanophenyl)methylidene]-5,5-dimethyl-4H-pyrazol-1-ium-3-olate (PubChem CID 46919349) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is (1Z)-1-[(4-cyanophenyl)methylidene]-5,5-dimethyl-4H-pyrazol-1-ium-3-olate.
| Compound Name | (1Z)-1-[(4-cyanophenyl)methylidene]-5,5-dimethyl-4H-pyrazol-1-ium-3-olate |
|---|---|
| PubChem CID | 46919349 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (1Z)-1-[(4-cyanophenyl)methylidene]-5,5-dimethyl-4H-pyrazol-1-ium-3-olate |
| SMILES | CC1(C)CC([O-])=N/[N+]1=C\c1ccc(C#N)cc1 |
| InChI | InChI=1S/C13H13N3O/c1-13(2)7-12(17)15-16(13)9-11-5-3-10(8-14)4-6-11/h3-6,9H,7H2,1-2H3/b16-9- |
| InChIKey | JAOCIAPBENAZQI-SXGWCWSVSA-N |
| XLogP | 0.85 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|