C16H22N2O — CID 134925258
(2E,4S)-2-benzylidene-4-hexyl-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 134925258) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is (2E,4S)-2-benzylidene-4-hexyl-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2E,4S)-2-benzylidene-4-hexyl-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 134925258 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (2E,4S)-2-benzylidene-4-hexyl-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | CCCCCC[C@H]1C/[N+](=C\c2ccccc2)N=C1[O-] |
| InChI | InChI=1S/C16H22N2O/c1-2-3-4-8-11-15-13-18(17-16(15)19)12-14-9-6-5-7-10-14/h5-7,9-10,12,15H,2-4,8,11,13H2,1H3/b18-12+/t15-/m0/s1 |
| InChIKey | JCEZHSKFDGAXOE-BRFSQIRFSA-N |
| XLogP | 2.39 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|