C16H21BrN2O — CID 134925283
(2Z,4S)-2-[(3-bromophenyl)methylidene]-4-hexyl-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 134925283) has the molecular formula C16H21BrN2O and a molecular weight of 337.26 g/mol. Its IUPAC name is (2Z,4S)-2-[(3-bromophenyl)methylidene]-4-hexyl-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z,4S)-2-[(3-bromophenyl)methylidene]-4-hexyl-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 134925283 |
| Molecular Formula | C16H21BrN2O |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | (2Z,4S)-2-[(3-bromophenyl)methylidene]-4-hexyl-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | CCCCCC[C@H]1C/[N+](=C/c2cccc(Br)c2)N=C1[O-] |
| InChI | InChI=1S/C16H21BrN2O/c1-2-3-4-5-8-14-12-19(18-16(14)20)11-13-7-6-9-15(17)10-13/h6-7,9-11,14H,2-5,8,12H2,1H3/b19-11-/t14-/m0/s1 |
| InChIKey | CLSBCAIHJDKXNU-KVMVOAJRSA-N |
| XLogP | 3.15 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|