C17H24N2O — CID 134925394
(2Z,4S)-4-hexyl-2-[(4-methylphenyl)methylidene]-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 134925394) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is (2Z,4S)-4-hexyl-2-[(4-methylphenyl)methylidene]-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z,4S)-4-hexyl-2-[(4-methylphenyl)methylidene]-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 134925394 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (2Z,4S)-4-hexyl-2-[(4-methylphenyl)methylidene]-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | CCCCCC[C@H]1C/[N+](=C/c2ccc(C)cc2)N=C1[O-] |
| InChI | InChI=1S/C17H24N2O/c1-3-4-5-6-7-16-13-19(18-17(16)20)12-15-10-8-14(2)9-11-15/h8-12,16H,3-7,13H2,1-2H3/b19-12-/t16-/m0/s1 |
| InChIKey | KAQBPGZCTJRNSL-JJBLJPBOSA-N |
| XLogP | 2.70 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|